CAS 23148-74-5 is the registry number for Thiamine Impurity 9. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-2-[(4-amino-2-methylpyrimidin-5-yl)methyl-formylamino]-5-hydroxypent-2-ene-3-thiolate (CAS 23148-74-5) is a chemical compound with the molecular formula C12H17N4O2S- and a molecular weight of 281.36 g/mol. IUPAC name: (E)-2-[(4-amino-2-methylpyrimidin-5-yl)methyl-formylamino]-5-hydroxypent-2-ene-3-thiolate. InChIKey: IDPJGITXELWXRN-DHZHZOJOSA-M.
| Molecular formula | C12H17N4O2S- |
|---|---|
| Molecular weight | 281.36 g/mol |
| IUPAC name | (E)-2-[(4-amino-2-methylpyrimidin-5-yl)methyl-formylamino]-5-hydroxypent-2-ene-3-thiolate |
| InChIKey | IDPJGITXELWXRN-DHZHZOJOSA-M |
| SMILES | CC1=NC=C(C(=N1)N)CN(C=O)/C(=C(\CCO)/[S-])/C |
Computed by PubChem (NCBI)