CAS 2315450-35-0 is the registry number for Kv7.2/Kv7.3 agonist 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[3-amino-6-[(4-fluorophenyl)methoxy]-2-pyridinyl]acetamide (CAS 2315450-35-0) is a chemical compound with the molecular formula C14H14FN3O2 and a molecular weight of 275.28 g/mol. IUPAC name: N-[3-amino-6-[(4-fluorophenyl)methoxy]-2-pyridinyl]acetamide. InChIKey: KOEZKXXQXWGVBY-UHFFFAOYSA-N.
| Molecular formula | C14H14FN3O2 |
|---|---|
| Molecular weight | 275.28 g/mol |
| IUPAC name | N-[3-amino-6-[(4-fluorophenyl)methoxy]-2-pyridinyl]acetamide |
| InChIKey | KOEZKXXQXWGVBY-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=CC(=N1)OCC2=CC=C(C=C2)F)N |
Computed by PubChem (NCBI)