CAS 231609-62-4 is the registry number for (2S,3R)-3-Isopropylazetidine-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3R)-3-propan-2-ylazetidine-2-carboxylic acid (CAS 231609-62-4) is a chemical compound with the molecular formula C7H13NO2 and a molecular weight of 143.18 g/mol. IUPAC name: (2S,3R)-3-propan-2-ylazetidine-2-carboxylic acid. InChIKey: VCXMOGULLXHZRZ-WDSKDSINSA-N.
| Molecular formula | C7H13NO2 |
|---|---|
| Molecular weight | 143.18 g/mol |
| IUPAC name | (2S,3R)-3-propan-2-ylazetidine-2-carboxylic acid |
| InChIKey | VCXMOGULLXHZRZ-WDSKDSINSA-N |
| SMILES | CC(C)[C@@H]1CN[C@@H]1C(=O)O |
Computed by PubChem (NCBI)