CAS 231616-87-8 is the registry number for (R)-1-(2,5-Dimethoxyphenyl)ethan-1-amine, 95%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
(1R)-1-(2,5-dimethoxyphenyl)ethanamine (CAS 231616-87-8) is a chemical compound with the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. IUPAC name: (1R)-1-(2,5-dimethoxyphenyl)ethanamine. InChIKey: ZWYIVRRLANGKDU-SSDOTTSWSA-N.
| Molecular formula | C10H15NO2 |
|---|---|
| Molecular weight | 181.23 g/mol |
| IUPAC name | (1R)-1-(2,5-dimethoxyphenyl)ethanamine |
| InChIKey | ZWYIVRRLANGKDU-SSDOTTSWSA-N |
| SMILES | C[C@H](C1=C(C=CC(=C1)OC)OC)N |
Computed by PubChem (NCBI)