CAS 2316459-16-0 appears in our catalog under these names: 3,3-Difluoro-1-(1H-triazol-5-yl)cyclobutanamine dihydrochloride, 3,3-difluoro-1-(1H-1,2,3-triazol-4-yl)cyclobutan-1-amine dihydrochloride, 97%, 97%, 3,3-DIFLUORO-1-(1H-1,2,3-TRIAZOL-5-YL)CYCLOBUTAN-1-AMINE DIHYDROCHLORIDE, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 500mg, 1g.
3,3-difluoro-1-(2H-triazol-4-yl)cyclobutan-1-amine;dihydrochloride (CAS 2316459-16-0) is a chemical compound with the molecular formula C6H10Cl2F2N4 and a molecular weight of 247.07 g/mol. IUPAC name: 3,3-difluoro-1-(2H-triazol-4-yl)cyclobutan-1-amine;dihydrochloride. InChIKey: JUBOFPRGGADZHT-UHFFFAOYSA-N.
| Molecular formula | C6H10Cl2F2N4 |
|---|---|
| Molecular weight | 247.07 g/mol |
| IUPAC name | 3,3-difluoro-1-(2H-triazol-4-yl)cyclobutan-1-amine;dihydrochloride |
| InChIKey | JUBOFPRGGADZHT-UHFFFAOYSA-N |
| SMILES | C1C(CC1(F)F)(C2=NNN=C2)N.Cl.Cl |
Computed by PubChem (NCBI)