Products 2316847-95-5
CAS 2316847-95-5 appears in our catalog under these names: Afatinib Impurity 60, Afatinib Impurity 115. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(Z)-N-[4-(3-chloro-4-fluoroanilino)-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]-3-hydroxybut-2-enamide (CAS 2316847-95-5) is a chemical compound with the molecular formula C22H20ClFN4O4 and a molecular weight of 458.9 g/mol. IUPAC name: (Z)-N-[4-(3-chloro-4-fluoroanilino)-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]-3-hydroxybut-2-enamide. InChIKey: NKPFWAKTFCKEMS-ZDWRTJATSA-N.
| Molecular formula | C22H20ClFN4O4 |
|---|---|
| Molecular weight | 458.9 g/mol |
| IUPAC name | (Z)-N-[4-(3-chloro-4-fluoroanilino)-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]-3-hydroxybut-2-enamide |
| InChIKey | NKPFWAKTFCKEMS-ZDWRTJATSA-N |
| SMILES | C/C(=C/C(=O)NC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC(=C(C=C3)F)Cl)O[C@H]4CCOC4)/O |
Computed by PubChem (NCBI)
Synonyms:
Afatinib Impurity 60