Products 23197-96-8
CAS 23197-96-8 appears in our catalog under these names: Purine riboside triphosphate, Purine riboside-5'-triphosphate, Purine riboside triphosphate. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 25mg, Get quote.
[[(2R,3S,4R,5R)-3,4-dihydroxy-5-purin-9-yloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (CAS 23197-96-8) is a chemical compound with the molecular formula C10H15N4O13P3 and a molecular weight of 492.17 g/mol. IUPAC name: [[(2R,3S,4R,5R)-3,4-dihydroxy-5-purin-9-yloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate. InChIKey: IZBXQTSTGHQGKL-FDDDBJFASA-N.
| Molecular formula | C10H15N4O13P3 |
|---|---|
| Molecular weight | 492.17 g/mol |
| IUPAC name | [[(2R,3S,4R,5R)-3,4-dihydroxy-5-purin-9-yloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| InChIKey | IZBXQTSTGHQGKL-FDDDBJFASA-N |
| SMILES | C1=C2C(=NC=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Purine riboside triphosphate, orb1691006