CAS 2319838-82-7 appears in our catalog under these names: AGN 193109 (sodium salt), AGN 193109 (sodium). Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 500μg, Get quote.
Sodium 4-[2-[5,5-dimethyl-8-(4-methylphenyl)-6H-naphthalen-2-yl]ethynyl]benzoate (CAS 2319838-82-7) is a chemical compound with the molecular formula C28H23NaO2 and a molecular weight of 414.5 g/mol. IUPAC name: sodium 4-[2-[5,5-dimethyl-8-(4-methylphenyl)-6H-naphthalen-2-yl]ethynyl]benzoate. InChIKey: JPAQKCQBQPEIHW-UHFFFAOYSA-M.
| Molecular formula | C28H23NaO2 |
|---|---|
| Molecular weight | 414.5 g/mol |
| IUPAC name | sodium 4-[2-[5,5-dimethyl-8-(4-methylphenyl)-6H-naphthalen-2-yl]ethynyl]benzoate |
| InChIKey | JPAQKCQBQPEIHW-UHFFFAOYSA-M |
| SMILES | CC1=CC=C(C=C1)C2=CCC(C3=C2C=C(C=C3)C#CC4=CC=C(C=C4)C(=O)[O-])(C)C.[Na+] |
Computed by PubChem (NCBI)