CAS 23202-73-5 is the registry number for 1-(β-Glucosyl)glycerol. Offered by: Biosynth. Available pack sizes: 2mg, 1mg, 5mg, 25mg, 10mg.
(2R,3R,4S,5S,6R)-2-[(2R)-2,3-dihydroxypropoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 23202-73-5) is a chemical compound with the molecular formula C9H18O8 and a molecular weight of 254.23 g/mol. IUPAC name: (2R,3R,4S,5S,6R)-2-[(2R)-2,3-dihydroxypropoxy]-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: NHJUPBDCSOGIKX-VMQOHUEUSA-N.
| Molecular formula | C9H18O8 |
|---|---|
| Molecular weight | 254.23 g/mol |
| IUPAC name | (2R,3R,4S,5S,6R)-2-[(2R)-2,3-dihydroxypropoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | NHJUPBDCSOGIKX-VMQOHUEUSA-N |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)OC[C@@H](CO)O)O)O)O)O |
Computed by PubChem (NCBI)