CAS 23214-93-9 appears in our catalog under these names: Chloramphenicol 1-Acetate, >95% (HPLC), Chloramphenicol 1–Acetate, Chloramphenicol 1-Acetate, ≥98%, ≥98%, Chloramphenicol 1-acetate. Offered by: TRC, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 2,5mg, 25mg, 5mg, 2.5mg.
[(1R,2R)-2-[(2,2-dichloroacetyl)amino]-3-hydroxy-1-(4-nitrophenyl)propyl] acetate (CAS 23214-93-9) is a chemical compound with the molecular formula C13H14Cl2N2O6 and a molecular weight of 365.16 g/mol. IUPAC name: [(1R,2R)-2-[(2,2-dichloroacetyl)amino]-3-hydroxy-1-(4-nitrophenyl)propyl] acetate. InChIKey: WEYAPUCXWINQDH-GHMZBOCLSA-N.
| Molecular formula | C13H14Cl2N2O6 |
|---|---|
| Molecular weight | 365.16 g/mol |
| IUPAC name | [(1R,2R)-2-[(2,2-dichloroacetyl)amino]-3-hydroxy-1-(4-nitrophenyl)propyl] acetate |
| InChIKey | WEYAPUCXWINQDH-GHMZBOCLSA-N |
| SMILES | CC(=O)O[C@H](C1=CC=C(C=C1)[N+](=O)[O-])[C@@H](CO)NC(=O)C(Cl)Cl |
Computed by PubChem (NCBI)