CAS 2322290-93-5 appears in our catalog under these names: 306Oi10, 306Oi10, 98%, 306Oi10 98%, 306Oi10, ≥98%, ≥98%, 306Oi10, 98.07%. Offered by: GLPBio, AmBeed, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 100mg, 10mg, 25mg, 50mg, 2mg, 5 mg, 10 mg.
8-methylnonyl 3-[3-[3-[bis[3-(8-methylnonoxy)-3-oxopropyl]amino]propyl-methylamino]propyl-[3-(8-methylnonoxy)-3-oxopropyl]amino]propanoate (CAS 2322290-93-5) is a chemical compound with the molecular formula C59H115N3O8 and a molecular weight of 994.6 g/mol. IUPAC name: 8-methylnonyl 3-[3-[3-[bis[3-(8-methylnonoxy)-3-oxopropyl]amino]propyl-methylamino]propyl-[3-(8-methylnonoxy)-3-oxopropyl]amino]propanoate. InChIKey: BPPZRZOKGADTQE-UHFFFAOYSA-N.
| Molecular formula | C59H115N3O8 |
|---|---|
| Molecular weight | 994.6 g/mol |
| IUPAC name | 8-methylnonyl 3-[3-[3-[bis[3-(8-methylnonoxy)-3-oxopropyl]amino]propyl-methylamino]propyl-[3-(8-methylnonoxy)-3-oxopropyl]amino]propanoate |
| InChIKey | BPPZRZOKGADTQE-UHFFFAOYSA-N |
| SMILES | CC(C)CCCCCCCOC(=O)CCN(CCCN(C)CCCN(CCC(=O)OCCCCCCCC(C)C)CCC(=O)OCCCCCCCC(C)C)CCC(=O)OCCCCCCCC(C)C |
Computed by PubChem (NCBI)