CAS 2322507-27-5 is the registry number for 2,5-Dichloro-3-(difluoromethyl)quinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,5-dichloro-3-(difluoromethyl)quinoline (CAS 2322507-27-5) is a chemical compound with the molecular formula C10H5Cl2F2N and a molecular weight of 248.05 g/mol. IUPAC name: 2,5-dichloro-3-(difluoromethyl)quinoline. InChIKey: QNIRQQJXTOYTIT-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2F2N |
|---|---|
| Molecular weight | 248.05 g/mol |
| IUPAC name | 2,5-dichloro-3-(difluoromethyl)quinoline |
| InChIKey | QNIRQQJXTOYTIT-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=C(C=C2C(=C1)Cl)C(F)F)Cl |
Computed by PubChem (NCBI)