Products 232280-76-1

CAS 232280-76-1 is the registry number for 2-(Aminomethyl)thiazole-4-carbothioamide 95%. Offered by: Ambeed. Available pack sizes: 5g, 25mg, 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(aminomethyl)-1,3-thiazole-4-carbothioamide (CAS 232280-76-1) is a chemical compound with the molecular formula C5H7N3S2 and a molecular weight of 173.3 g/mol. IUPAC name: 2-(aminomethyl)-1,3-thiazole-4-carbothioamide. InChIKey: KKFAAUVAMMLJDF-UHFFFAOYSA-N.

Identity
Molecular formulaC5H7N3S2
Molecular weight173.3 g/mol
IUPAC name2-(aminomethyl)-1,3-thiazole-4-carbothioamide
InChIKeyKKFAAUVAMMLJDF-UHFFFAOYSA-N
SMILESC1=C(N=C(S1)CN)C(=S)N

Computed by PubChem (NCBI)