CAS 232281-44-6 appears in our catalog under these names: Potassium hydroxycitrate tribasic monohydrate, 95%, Potassium hydroxycitrate tribasic monohydrate, Hydroxycitric acid tripotassium monohydrate, Hydroxycitric acid (tripotassium), 98.0%. Offered by: Combi-blocks, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1g, 5g, 250mg, 0,25g, 0,1g, 0,5g, 25 mg, 100 mg.
Dipotassium;2-(2-hydroperoxy-2-oxoethyl)-2-hydroxybutanedioate (CAS 232281-44-6) is a chemical compound with the molecular formula C6H6K2O8 and a molecular weight of 284.30 g/mol. IUPAC name: dipotassium;2-(2-hydroperoxy-2-oxoethyl)-2-hydroxybutanedioate. InChIKey: DBODYJNKCUPHHN-UHFFFAOYSA-L.
| Molecular formula | C6H6K2O8 |
|---|---|
| Molecular weight | 284.30 g/mol |
| IUPAC name | dipotassium;2-(2-hydroperoxy-2-oxoethyl)-2-hydroxybutanedioate |
| InChIKey | DBODYJNKCUPHHN-UHFFFAOYSA-L |
| SMILES | C(C(=O)[O-])C(CC(=O)OO)(C(=O)[O-])O.[K+].[K+] |
Computed by PubChem (NCBI)