CAS 2322869-99-6 appears in our catalog under these names: (S)-3,3,3-Trifluoropropane-1,2-diamine dihydrochloride, 97%, 97%, (S)-3,3,3-Trifluoropropane-1,2-diamine dihydrochloride, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
(2S)-3,3,3-trifluoropropane-1,2-diamine;dihydrochloride (CAS 2322869-99-6) is a chemical compound with the molecular formula C3H9Cl2F3N2 and a molecular weight of 201.02 g/mol. IUPAC name: (2S)-3,3,3-trifluoropropane-1,2-diamine;dihydrochloride. InChIKey: PWIDCEVCHKDDMQ-JIZZDEOASA-N.
| Molecular formula | C3H9Cl2F3N2 |
|---|---|
| Molecular weight | 201.02 g/mol |
| IUPAC name | (2S)-3,3,3-trifluoropropane-1,2-diamine;dihydrochloride |
| InChIKey | PWIDCEVCHKDDMQ-JIZZDEOASA-N |
| SMILES | C([C@@H](C(F)(F)F)N)N.Cl.Cl |
Computed by PubChem (NCBI)