Products 2322886-10-0
CAS 2322886-10-0 is the registry number for methyl 1-(3-bromophenyl)-3,3-dimethoxycyclobutane-1-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
2-chloro-6-iodo-3-(trifluoromethyl)phenol (CAS 2322886-10-0) is a chemical compound with the molecular formula C7H3ClF3IO and a molecular weight of 322.45 g/mol. IUPAC name: 2-chloro-6-iodo-3-(trifluoromethyl)phenol. InChIKey: XBFDCXTTYXLCIR-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3IO |
|---|---|
| Molecular weight | 322.45 g/mol |
| IUPAC name | 2-chloro-6-iodo-3-(trifluoromethyl)phenol |
| InChIKey | XBFDCXTTYXLCIR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(F)(F)F)Cl)O)I |
Computed by PubChem (NCBI)