CAS 2323053-49-0 is the registry number for 4,6-Diisopropyl-2-methoxypyrimidin-5-amine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methoxy-4,6-di(propan-2-yl)pyrimidin-5-amine (CAS 2323053-49-0) is a chemical compound with the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. IUPAC name: 2-methoxy-4,6-di(propan-2-yl)pyrimidin-5-amine. InChIKey: FUWJCPVDYQDVPG-UHFFFAOYSA-N.
| Molecular formula | C11H19N3O |
|---|---|
| Molecular weight | 209.29 g/mol |
| IUPAC name | 2-methoxy-4,6-di(propan-2-yl)pyrimidin-5-amine |
| InChIKey | FUWJCPVDYQDVPG-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=NC(=N1)OC)C(C)C)N |
Computed by PubChem (NCBI)