CAS 2323071-10-7 is the registry number for 2-[5-(3-Chlorobenzyl)-1,3-oxazol-2-yl]piperidine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-[(3-chlorophenyl)methyl]-2-piperidin-2-yl-1,3-oxazole;hydrochloride (CAS 2323071-10-7) is a chemical compound with the molecular formula C15H18Cl2N2O and a molecular weight of 313.2 g/mol. IUPAC name: 5-[(3-chlorophenyl)methyl]-2-piperidin-2-yl-1,3-oxazole;hydrochloride. InChIKey: HUIYJNFENLJNFP-UHFFFAOYSA-N.
| Molecular formula | C15H18Cl2N2O |
|---|---|
| Molecular weight | 313.2 g/mol |
| IUPAC name | 5-[(3-chlorophenyl)methyl]-2-piperidin-2-yl-1,3-oxazole;hydrochloride |
| InChIKey | HUIYJNFENLJNFP-UHFFFAOYSA-N |
| SMILES | C1CCNC(C1)C2=NC=C(O2)CC3=CC(=CC=C3)Cl.Cl |
Computed by PubChem (NCBI)