CAS 23235-99-6 appears in our catalog under these names: 1,6-Anhydro-2-deoxy-2-fluoro-b-D-glucopyranose, 1,6-Anhydro-2-deoxy-2-fluoro-β-D-glucopyranose. Offered by: Biosynth, Chemat. Available pack sizes: 100mg, 50mg, 1g, 250mg, 500mg.
(2S,3R,5R)-4-fluoro-6,8-dioxabicyclo[3.2.1]octane-2,3-diol (CAS 23235-99-6) is a chemical compound with the molecular formula C6H9FO4 and a molecular weight of 164.13 g/mol. IUPAC name: (2S,3R,5R)-4-fluoro-6,8-dioxabicyclo[3.2.1]octane-2,3-diol. InChIKey: BWYPOWJFUBKPNS-RKFISERESA-N.
| Molecular formula | C6H9FO4 |
|---|---|
| Molecular weight | 164.13 g/mol |
| IUPAC name | (2S,3R,5R)-4-fluoro-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
| InChIKey | BWYPOWJFUBKPNS-RKFISERESA-N |
| SMILES | C1C2[C@H]([C@H](C([C@H](O1)O2)F)O)O |
Computed by PubChem (NCBI)