CAS 2324090-30-2 is the registry number for Methyl (S)-4-bromo-2-((1,1,1-trifluoropropan-2-yl)oxy)benzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-bromo-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxybenzoate (CAS 2324090-30-2) is a chemical compound with the molecular formula C11H10BrF3O3 and a molecular weight of 327.09 g/mol. IUPAC name: methyl 4-bromo-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxybenzoate. InChIKey: HJYXKMMGHXOUGX-LURJTMIESA-N.
| Molecular formula | C11H10BrF3O3 |
|---|---|
| Molecular weight | 327.09 g/mol |
| IUPAC name | methyl 4-bromo-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxybenzoate |
| InChIKey | HJYXKMMGHXOUGX-LURJTMIESA-N |
| SMILES | C[C@@H](C(F)(F)F)OC1=C(C=CC(=C1)Br)C(=O)OC |
Computed by PubChem (NCBI)