CAS 2324831-15-2 appears in our catalog under these names: Palbociclib Impurity 19, Palbociclib Impurity T, Palbociclib Impurity 23, 6-Bromo-5-(bromomethyl)-2-chloro-8-cyclopentylpyrido[2,3-d]pyrimidin-7(8H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-5-(bromomethyl)-2-chloro-8-cyclopentylpyrido[2,3-d]pyrimidin-7-one (CAS 2324831-15-2) is a chemical compound with the molecular formula C13H12Br2ClN3O and a molecular weight of 421.51 g/mol. IUPAC name: 6-bromo-5-(bromomethyl)-2-chloro-8-cyclopentylpyrido[2,3-d]pyrimidin-7-one. InChIKey: KJXTZGCEBDAVJL-UHFFFAOYSA-N.
| Molecular formula | C13H12Br2ClN3O |
|---|---|
| Molecular weight | 421.51 g/mol |
| IUPAC name | 6-bromo-5-(bromomethyl)-2-chloro-8-cyclopentylpyrido[2,3-d]pyrimidin-7-one |
| InChIKey | KJXTZGCEBDAVJL-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)N2C3=NC(=NC=C3C(=C(C2=O)Br)CBr)Cl |
Computed by PubChem (NCBI)