Products 23250-03-5

CAS 23250-03-5 appears in our catalog under these names: (2–Hydroxyethyl)triphenylphosphonium chloride, (2-Hydroxyethyl)triphenylphosphonium chloride, 95%, 95%, (2-Hydroxyethyl)triphenylphosphonium chloride, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 10g, 100g, 500g.

Structural formula: {0} (CAS {1})

2-hydroxyethyl(triphenyl)phosphanium chloride (CAS 23250-03-5) is a chemical compound with the molecular formula C20H20ClOP and a molecular weight of 342.8 g/mol. IUPAC name: 2-hydroxyethyl(triphenyl)phosphanium chloride. InChIKey: NOEABYSOSUWXKG-UHFFFAOYSA-M.

Identity
Molecular formulaC20H20ClOP
Molecular weight342.8 g/mol
IUPAC name2-hydroxyethyl(triphenyl)phosphanium chloride
InChIKeyNOEABYSOSUWXKG-UHFFFAOYSA-M
SMILESC1=CC=C(C=C1)[P+](CCO)(C2=CC=CC=C2)C3=CC=CC=C3.[Cl-]

Computed by PubChem (NCBI)