CAS 232587-50-7 is the registry number for 1H,1H-Perfluoro-3,7-dimethyl-1-octanol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2,2,3,4,4,5,5,6,6,7,8,8,8-tridecafluoro-3,7-bis(trifluoromethyl)octan-1-ol (CAS 232587-50-7) is a chemical compound with the molecular formula C10H3F19O and a molecular weight of 500.10 g/mol. IUPAC name: 2,2,3,4,4,5,5,6,6,7,8,8,8-tridecafluoro-3,7-bis(trifluoromethyl)octan-1-ol. InChIKey: ZVOWIXGGKDLFPF-UHFFFAOYSA-N.
| Molecular formula | C10H3F19O |
|---|---|
| Molecular weight | 500.10 g/mol |
| IUPAC name | 2,2,3,4,4,5,5,6,6,7,8,8,8-tridecafluoro-3,7-bis(trifluoromethyl)octan-1-ol |
| InChIKey | ZVOWIXGGKDLFPF-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(C(C(C(F)(F)F)(C(F)(F)F)F)(F)F)(F)F)(F)F)(C(F)(F)F)F)(F)F)O |
Computed by PubChem (NCBI)