Products 23268-03-3

CAS 23268-03-3 is the registry number for 4-Methoxy-2-methyl-4-oxobutanoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-methoxy-2-methyl-4-oxobutanoate (CAS 23268-03-3) is a chemical compound with the molecular formula C6H9O4- and a molecular weight of 145.13 g/mol. IUPAC name: 4-methoxy-2-methyl-4-oxobutanoate. InChIKey: UVQYBUYGFBXQGO-UHFFFAOYSA-M.

Identity
Molecular formulaC6H9O4-
Molecular weight145.13 g/mol
IUPAC name4-methoxy-2-methyl-4-oxobutanoate
InChIKeyUVQYBUYGFBXQGO-UHFFFAOYSA-M
SMILESCC(CC(=O)OC)C(=O)[O-]

Computed by PubChem (NCBI)