Products 2327127-53-5
CAS 2327127-53-5 appears in our catalog under these names: ethyl trans–1–benzyl–4–(4–isopropylphenyl)pyrrolidine–3–carboxylate, ethyl trans-1-benzyl-4-(4-isopropylphenyl)pyrrolidine-3-carboxylate. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 5g.
Ethyl (3R,4S)-1-benzyl-4-(4-propan-2-ylphenyl)pyrrolidine-3-carboxylate (CAS 2327127-53-5) is a chemical compound with the molecular formula C23H29NO2 and a molecular weight of 351.5 g/mol. IUPAC name: ethyl (3R,4S)-1-benzyl-4-(4-propan-2-ylphenyl)pyrrolidine-3-carboxylate. InChIKey: ZIDWUVPZBBULNK-YADHBBJMSA-N.
| Molecular formula | C23H29NO2 |
|---|---|
| Molecular weight | 351.5 g/mol |
| IUPAC name | ethyl (3R,4S)-1-benzyl-4-(4-propan-2-ylphenyl)pyrrolidine-3-carboxylate |
| InChIKey | ZIDWUVPZBBULNK-YADHBBJMSA-N |
| SMILES | CCOC(=O)[C@H]1CN(C[C@@H]1C2=CC=C(C=C2)C(C)C)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)