Products 2327184-31-4
CAS 2327184-31-4 appears in our catalog under these names: ethyl trans–1–benzyl–4–(4–(tert–butyl)phenyl)pyrrolidine–3–carboxylate, ethyl trans-1-benzyl-4-(4-(tert-butyl)phenyl)pyrrolidine-3-carboxylate. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 50mg.
Ethyl (3R,4S)-1-benzyl-4-(4-tert-butylphenyl)pyrrolidine-3-carboxylate (CAS 2327184-31-4) is a chemical compound with the molecular formula C24H31NO2 and a molecular weight of 365.5 g/mol. IUPAC name: ethyl (3R,4S)-1-benzyl-4-(4-tert-butylphenyl)pyrrolidine-3-carboxylate. InChIKey: WVZYGSZLLFCKTI-YADHBBJMSA-N.
| Molecular formula | C24H31NO2 |
|---|---|
| Molecular weight | 365.5 g/mol |
| IUPAC name | ethyl (3R,4S)-1-benzyl-4-(4-tert-butylphenyl)pyrrolidine-3-carboxylate |
| InChIKey | WVZYGSZLLFCKTI-YADHBBJMSA-N |
| SMILES | CCOC(=O)[C@H]1CN(C[C@@H]1C2=CC=C(C=C2)C(C)(C)C)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)