CAS 2327297-30-1 is the registry number for IAV replication-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[5-methoxy-1-(4-methylphenyl)sulfonyl-3-phenylindol-2-yl]methanesulfonamide (CAS 2327297-30-1) is a chemical compound with the molecular formula C23H22N2O5S2 and a molecular weight of 470.6 g/mol. IUPAC name: N-[5-methoxy-1-(4-methylphenyl)sulfonyl-3-phenylindol-2-yl]methanesulfonamide. InChIKey: MOUNZZQSSSSEFO-UHFFFAOYSA-N.
| Molecular formula | C23H22N2O5S2 |
|---|---|
| Molecular weight | 470.6 g/mol |
| IUPAC name | N-[5-methoxy-1-(4-methylphenyl)sulfonyl-3-phenylindol-2-yl]methanesulfonamide |
| InChIKey | MOUNZZQSSSSEFO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C3=C(C=C(C=C3)OC)C(=C2NS(=O)(=O)C)C4=CC=CC=C4 |
Computed by PubChem (NCBI)