CAS 2327958-55-2 is the registry number for 4-Amino-3-(5-fluoro-1H-indol-3-yl)tetrahydro-2H-thiopyran 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(5-fluoro-1H-indol-3-yl)-1,1-dioxothian-4-amine (CAS 2327958-55-2) is a chemical compound with the molecular formula C13H15FN2O2S and a molecular weight of 282.34 g/mol. IUPAC name: 3-(5-fluoro-1H-indol-3-yl)-1,1-dioxothian-4-amine. InChIKey: QSMKHRCJTWLNEA-UHFFFAOYSA-N.
| Molecular formula | C13H15FN2O2S |
|---|---|
| Molecular weight | 282.34 g/mol |
| IUPAC name | 3-(5-fluoro-1H-indol-3-yl)-1,1-dioxothian-4-amine |
| InChIKey | QSMKHRCJTWLNEA-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC(C1N)C2=CNC3=C2C=C(C=C3)F |
Computed by PubChem (NCBI)