Products 2328024-55-9

CAS 2328024-55-9 is the registry number for Perfluoroheptanoic acid 13C4 (1,2,3,4-13C4) 50 µg/mL in Methanol:Water. Offered by: Dr. Ehrenstorfer. Available pack sizes: 1ml.

Structural formula: {0} (CAS {1})

2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro(1,2,3,4-13C4)heptanoic acid (CAS 2328024-55-9) is a chemical compound with the molecular formula C7HF13O2 and a molecular weight of 368.03 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro(1,2,3,4-13C4)heptanoic acid. InChIKey: ZWBAMYVPMDSJGQ-JCDJMFQYSA-N.

Identity
Molecular formulaC7HF13O2
Molecular weight368.03 g/mol
IUPAC name2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro(1,2,3,4-13C4)heptanoic acid
InChIKeyZWBAMYVPMDSJGQ-JCDJMFQYSA-N
SMILES[13C](=O)([13C]([13C]([13C](C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O

Computed by PubChem (NCBI)