CAS 2328099-08-5 appears in our catalog under these names: IDO1–IN–18, IDO1-IN-18, 98%, 98%, IDO1-IN-18, 98.77%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 1mg, 50 mg, 100 mg, 5 mg.
N-(4-fluorophenyl)-3-[4-[4-(hydroxymethyl)-6-(trifluoromethyl)-3-pyridinyl]phenyl]oxetane-3-carboxamide (CAS 2328099-08-5) is a chemical compound with the molecular formula C23H18F4N2O3 and a molecular weight of 446.4 g/mol. IUPAC name: N-(4-fluorophenyl)-3-[4-[4-(hydroxymethyl)-6-(trifluoromethyl)-3-pyridinyl]phenyl]oxetane-3-carboxamide. InChIKey: KTZHBUHZJXHRMG-UHFFFAOYSA-N.
| Molecular formula | C23H18F4N2O3 |
|---|---|
| Molecular weight | 446.4 g/mol |
| IUPAC name | N-(4-fluorophenyl)-3-[4-[4-(hydroxymethyl)-6-(trifluoromethyl)-3-pyridinyl]phenyl]oxetane-3-carboxamide |
| InChIKey | KTZHBUHZJXHRMG-UHFFFAOYSA-N |
| SMILES | C1C(CO1)(C2=CC=C(C=C2)C3=CN=C(C=C3CO)C(F)(F)F)C(=O)NC4=CC=C(C=C4)F |
Computed by PubChem (NCBI)