CAS 2328099-11-0 appears in our catalog under these names: IDO1–IN–19, IDO1-IN-19, 98%, 98%, IDO1-IN-19, 98.82%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 10 mg, 10mM/1mL, 5 mg, 25 mg, 50 mg.
N-(4-fluorophenyl)-3-[4-[4-(2-hydroxypropan-2-yl)-6-(trifluoromethyl)-3-pyridinyl]phenyl]oxetane-3-carboxamide (CAS 2328099-11-0) is a chemical compound with the molecular formula C25H22F4N2O3 and a molecular weight of 474.4 g/mol. IUPAC name: N-(4-fluorophenyl)-3-[4-[4-(2-hydroxypropan-2-yl)-6-(trifluoromethyl)-3-pyridinyl]phenyl]oxetane-3-carboxamide. InChIKey: ICJRFPZBMMQAPU-UHFFFAOYSA-N.
| Molecular formula | C25H22F4N2O3 |
|---|---|
| Molecular weight | 474.4 g/mol |
| IUPAC name | N-(4-fluorophenyl)-3-[4-[4-(2-hydroxypropan-2-yl)-6-(trifluoromethyl)-3-pyridinyl]phenyl]oxetane-3-carboxamide |
| InChIKey | ICJRFPZBMMQAPU-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=NC=C1C2=CC=C(C=C2)C3(COC3)C(=O)NC4=CC=C(C=C4)F)C(F)(F)F)O |
Computed by PubChem (NCBI)