CAS 2329208-91-3 is the registry number for trans-methyl 1-benzyl-4-(3-(trifluoromethyl)phenyl)pyrrolidine-3-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
2-benzyl-4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phthalazin-1-one (CAS 2329208-91-3) is a chemical compound with the molecular formula C17H12N4O2S and a molecular weight of 336.4 g/mol. IUPAC name: 2-benzyl-4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phthalazin-1-one. InChIKey: LVEKKDXKPJDYLK-UHFFFAOYSA-N.
| Molecular formula | C17H12N4O2S |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | 2-benzyl-4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phthalazin-1-one |
| InChIKey | LVEKKDXKPJDYLK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=O)C3=CC=CC=C3C(=N2)C4=NNC(=S)O4 |
Computed by PubChem (NCBI)