CAS 232938-43-1 appears in our catalog under these names: Pergafast 201, 3-(3-Tosylureido)phenyl 4-methylbenzenesulfonate, 98%. Offered by: TRC, AmBeed, Dr. Ehrenstorfer. Available pack sizes: 100mg, 1g, 500mg, 25g.
[3-[(4-methylphenyl)sulfonylcarbamoylamino]phenyl] 4-methylbenzenesulfonate (CAS 232938-43-1) is a chemical compound with the molecular formula C21H20N2O6S2 and a molecular weight of 460.5 g/mol. IUPAC name: [3-[(4-methylphenyl)sulfonylcarbamoylamino]phenyl] 4-methylbenzenesulfonate. InChIKey: HEVGMYPGMWZOBU-UHFFFAOYSA-N.
| Molecular formula | C21H20N2O6S2 |
|---|---|
| Molecular weight | 460.5 g/mol |
| IUPAC name | [3-[(4-methylphenyl)sulfonylcarbamoylamino]phenyl] 4-methylbenzenesulfonate |
| InChIKey | HEVGMYPGMWZOBU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC(=O)NC2=CC(=CC=C2)OS(=O)(=O)C3=CC=C(C=C3)C |
Computed by PubChem (NCBI)