CAS 23295-92-3 appears in our catalog under these names: (S)–3–Hydroxy–2–(Phosphonooxy)Propanoic Acid, L-2-Phosphoglyceric acid/ 98.72% (existing batch purity), L-2-PHOSPHOGLYCERIC ACID DISODIUM SALT H, L-2-Phosphoglyceric acid, 80%, 80%, L-2-Phosphoglyceric acid, 89.7%. Offered by: GLPBio, TargetMol, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 50mg, 1mg, 2mg, 5mg, 10mg, 25mg, 100mg, Get quote.
(2S)-3-hydroxy-2-phosphonooxypropanoic acid (CAS 23295-92-3) is a chemical compound with the molecular formula C3H7O7P and a molecular weight of 186.06 g/mol. IUPAC name: (2S)-3-hydroxy-2-phosphonooxypropanoic acid. InChIKey: GXIURPTVHJPJLF-REOHCLBHSA-N.
| Molecular formula | C3H7O7P |
|---|---|
| Molecular weight | 186.06 g/mol |
| IUPAC name | (2S)-3-hydroxy-2-phosphonooxypropanoic acid |
| InChIKey | GXIURPTVHJPJLF-REOHCLBHSA-N |
| SMILES | C([C@@H](C(=O)O)OP(=O)(O)O)O |
Computed by PubChem (NCBI)