CAS 2329573-94-4 is the registry number for (R)-3-Iodo-7-methyl-4,5,7,8-tetrahydro-1H-oxepino[4,5-c]pyrazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(7R)-3-iodo-7-methyl-4,5,7,8-tetrahydro-1H-oxepino[4,5-d]pyrazole (CAS 2329573-94-4) is a chemical compound with the molecular formula C8H11IN2O and a molecular weight of 278.09 g/mol. IUPAC name: (7R)-3-iodo-7-methyl-4,5,7,8-tetrahydro-1H-oxepino[4,5-d]pyrazole. InChIKey: DHGHICPRGUXWPQ-RXMQYKEDSA-N.
| Molecular formula | C8H11IN2O |
|---|---|
| Molecular weight | 278.09 g/mol |
| IUPAC name | (7R)-3-iodo-7-methyl-4,5,7,8-tetrahydro-1H-oxepino[4,5-d]pyrazole |
| InChIKey | DHGHICPRGUXWPQ-RXMQYKEDSA-N |
| SMILES | C[C@@H]1CC2=C(CCO1)C(=NN2)I |
Computed by PubChem (NCBI)