CAS 23308-83-0 appears in our catalog under these names: (2-Nitrobenzyl)triphenylphosphonium bromide 98%, (2-Nitrobenzyl)triphenylphosphonium bromide, 97%, 97%, (2-Nitrobenzyl)triphenylphosphonium bromide, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 200mg.
(2-nitrophenyl)methyl-triphenylphosphanium bromide (CAS 23308-83-0) is a chemical compound with the molecular formula C25H21BrNO2P and a molecular weight of 478.3 g/mol. IUPAC name: (2-nitrophenyl)methyl-triphenylphosphanium bromide. InChIKey: ATURWXASWONPRT-UHFFFAOYSA-M.
| Molecular formula | C25H21BrNO2P |
|---|---|
| Molecular weight | 478.3 g/mol |
| IUPAC name | (2-nitrophenyl)methyl-triphenylphosphanium bromide |
| InChIKey | ATURWXASWONPRT-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)[P+](CC2=CC=CC=C2[N+](=O)[O-])(C3=CC=CC=C3)C4=CC=CC=C4.[Br-] |
Computed by PubChem (NCBI)