CAS 2331211-45-9 is the registry number for (1S,3R)-3-(Methylamino)cyclohexan-1-ol hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-(1S,3R)-3-(methylamino)cyclohexan-1-ol;hydrochloride (CAS 2331211-45-9) is a chemical compound with the molecular formula C7H16ClNO and a molecular weight of 165.66 g/mol. IUPAC name: cis-(1S,3R)-3-(methylamino)cyclohexan-1-ol;hydrochloride. InChIKey: ZQRLUNHNWJYPLG-HHQFNNIRSA-N.
| Molecular formula | C7H16ClNO |
|---|---|
| Molecular weight | 165.66 g/mol |
| IUPAC name | cis-(1S,3R)-3-(methylamino)cyclohexan-1-ol;hydrochloride |
| InChIKey | ZQRLUNHNWJYPLG-HHQFNNIRSA-N |
| SMILES | CN[C@@H]1CCC[C@@H](C1)O.Cl |
Computed by PubChem (NCBI)