CAS 23325-63-5 is the registry number for Bis[2-(acetyloxy)benzoato]copper, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
Copper bis(2-acetyloxybenzoate) (CAS 23325-63-5) is a chemical compound with the molecular formula C18H14CuO8 and a molecular weight of 421.8 g/mol. IUPAC name: copper bis(2-acetyloxybenzoate). InChIKey: CMDYHTIDHSNRGW-UHFFFAOYSA-L.
| Molecular formula | C18H14CuO8 |
|---|---|
| Molecular weight | 421.8 g/mol |
| IUPAC name | copper bis(2-acetyloxybenzoate) |
| InChIKey | CMDYHTIDHSNRGW-UHFFFAOYSA-L |
| SMILES | CC(=O)OC1=CC=CC=C1C(=O)[O-].CC(=O)OC1=CC=CC=C1C(=O)[O-].[Cu+2] |
Computed by PubChem (NCBI)