Products 2332835-02-4
CAS 2332835-02-4 is the registry number for PSB-1901, 96.33%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 1 mg.
8-[4-[4-(4-bromophenyl)piperazin-1-yl]sulfonylphenyl]-1-propyl-3,7-dihydropurine-2,6-dione (CAS 2332835-02-4) is a chemical compound with the molecular formula C24H25BrN6O4S and a molecular weight of 573.5 g/mol. IUPAC name: 8-[4-[4-(4-bromophenyl)piperazin-1-yl]sulfonylphenyl]-1-propyl-3,7-dihydropurine-2,6-dione. InChIKey: UGKYSTLSSKLXJO-UHFFFAOYSA-N.
| Molecular formula | C24H25BrN6O4S |
|---|---|
| Molecular weight | 573.5 g/mol |
| IUPAC name | 8-[4-[4-(4-bromophenyl)piperazin-1-yl]sulfonylphenyl]-1-propyl-3,7-dihydropurine-2,6-dione |
| InChIKey | UGKYSTLSSKLXJO-UHFFFAOYSA-N |
| SMILES | CCCN1C(=O)C2=C(NC1=O)N=C(N2)C3=CC=C(C=C3)S(=O)(=O)N4CCN(CC4)C5=CC=C(C=C5)Br |
Computed by PubChem (NCBI)