CAS 23333-98-4 is the registry number for Zinc-L-lysine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Zinc bis((2S)-2,6-diaminohexanoate) (CAS 23333-98-4) is a chemical compound with the molecular formula C12H26N4O4Zn and a molecular weight of 355.7 g/mol. IUPAC name: zinc bis((2S)-2,6-diaminohexanoate). InChIKey: NJNDBGREJCHIFG-MDTVQASCSA-L.
| Molecular formula | C12H26N4O4Zn |
|---|---|
| Molecular weight | 355.7 g/mol |
| IUPAC name | zinc bis((2S)-2,6-diaminohexanoate) |
| InChIKey | NJNDBGREJCHIFG-MDTVQASCSA-L |
| SMILES | C(CCN)C[C@@H](C(=O)[O-])N.C(CCN)C[C@@H](C(=O)[O-])N.[Zn+2] |
Computed by PubChem (NCBI)