CAS 233584-42-4 appears in our catalog under these names: (3,5-Di-tert-butyl-4-methoxyphenyl)boronic acid, 95-<97%, (3,5-Di-tert-butyl-4-methoxyphenyl)boronic Acid, >95% (HPLC), (3,5-di-tert-butyl-4-methoxyphenyl)boronic acid, 95%, 95%, (3,5-Di-tert-butyl-4-methoxyphenyl)boronic acid, 95%. Offered by: Hoffman Fine Chemicals, TRC, Chemat, Fluorochem. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g, 50g, 100mg, 250mg.
(3,5-ditert-butyl-4-methoxyphenyl)boronic acid (CAS 233584-42-4) is a chemical compound with the molecular formula C15H25BO3 and a molecular weight of 264.17 g/mol. IUPAC name: (3,5-ditert-butyl-4-methoxyphenyl)boronic acid. InChIKey: CIYHLDPTVFBRGD-UHFFFAOYSA-N.
| Molecular formula | C15H25BO3 |
|---|---|
| Molecular weight | 264.17 g/mol |
| IUPAC name | (3,5-ditert-butyl-4-methoxyphenyl)boronic acid |
| InChIKey | CIYHLDPTVFBRGD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C(C)(C)C)OC)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)