CAS 233591-26-9 appears in our catalog under these names: Acamprosate Impurity 1 Calcium Salt, Acamprosate Impurity 3, 3-(Acetylmethylamino)-1-propanesulfonic Acid Calcium Salt, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2,5g, 250mg.
Calcium bis(3-[acetyl(methyl)amino]propane-1-sulfonate) (CAS 233591-26-9) is a chemical compound with the molecular formula C12H24CaN2O8S2 and a molecular weight of 428.5 g/mol. IUPAC name: calcium bis(3-[acetyl(methyl)amino]propane-1-sulfonate). InChIKey: JTVRLZRFSWNWAR-UHFFFAOYSA-L.
| Molecular formula | C12H24CaN2O8S2 |
|---|---|
| Molecular weight | 428.5 g/mol |
| IUPAC name | calcium bis(3-[acetyl(methyl)amino]propane-1-sulfonate) |
| InChIKey | JTVRLZRFSWNWAR-UHFFFAOYSA-L |
| SMILES | CC(=O)N(C)CCCS(=O)(=O)[O-].CC(=O)N(C)CCCS(=O)(=O)[O-].[Ca+2] |
Computed by PubChem (NCBI)