CAS 2338-64-9 is the registry number for 1,1,2,2,3,3-Hexafluoroindene. Offered by: TRC. Available pack sizes: 750mg.
1,1,2,2,3,3-hexafluoroindene (CAS 2338-64-9) is a chemical compound with the molecular formula C9H4F6 and a molecular weight of 226.12 g/mol. IUPAC name: 1,1,2,2,3,3-hexafluoroindene. InChIKey: LNYHPQJAJVEHPE-UHFFFAOYSA-N.
| Molecular formula | C9H4F6 |
|---|---|
| Molecular weight | 226.12 g/mol |
| IUPAC name | 1,1,2,2,3,3-hexafluoroindene |
| InChIKey | LNYHPQJAJVEHPE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C(C2(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)