CAS 23380-53-2 is the registry number for 7-Chloro-6-sulfamoylisatoic Anhydride. Offered by: TRC. Available pack sizes: 100mg.
7-chloro-2,4-dioxo-1H-3,1-benzoxazine-6-sulfonamide (CAS 23380-53-2) is a chemical compound with the molecular formula C8H5ClN2O5S and a molecular weight of 276.65 g/mol. IUPAC name: 7-chloro-2,4-dioxo-1H-3,1-benzoxazine-6-sulfonamide. InChIKey: OJRUZZLZXHSTAH-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O5S |
|---|---|
| Molecular weight | 276.65 g/mol |
| IUPAC name | 7-chloro-2,4-dioxo-1H-3,1-benzoxazine-6-sulfonamide |
| InChIKey | OJRUZZLZXHSTAH-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1S(=O)(=O)N)Cl)NC(=O)OC2=O |
Computed by PubChem (NCBI)