Products 2338764-89-7
CAS 2338764-89-7 is the registry number for p53 Activator 2. Offered by: MedChemExpress. Available pack sizes: Get quote.
N'-[2-[(E)-2-(4-nitrophenyl)ethenyl]quinazolin-4-yl]butane-1,4-diamine (CAS 2338764-89-7) is a chemical compound with the molecular formula C20H21N5O2 and a molecular weight of 363.4 g/mol. IUPAC name: N'-[2-[(E)-2-(4-nitrophenyl)ethenyl]quinazolin-4-yl]butane-1,4-diamine. InChIKey: GCVVGGBCJCPTQK-FMIVXFBMSA-N.
| Molecular formula | C20H21N5O2 |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | N'-[2-[(E)-2-(4-nitrophenyl)ethenyl]quinazolin-4-yl]butane-1,4-diamine |
| InChIKey | GCVVGGBCJCPTQK-FMIVXFBMSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NC(=N2)/C=C/C3=CC=C(C=C3)[N+](=O)[O-])NCCCCN |
Computed by PubChem (NCBI)
Synonyms:
p53 Activator 2, orb1688668