CAS 2340-84-3 is the registry number for 1H,1H,2H,3H-Perfluoroundec-2-en-1-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
(E)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundec-2-en-1-ol (CAS 2340-84-3) is a chemical compound with the molecular formula C11H5F17O and a molecular weight of 476.13 g/mol. IUPAC name: (E)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundec-2-en-1-ol. InChIKey: SZUDACTYWYPFLY-OWOJBTEDSA-N.
| Molecular formula | C11H5F17O |
|---|---|
| Molecular weight | 476.13 g/mol |
| IUPAC name | (E)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundec-2-en-1-ol |
| InChIKey | SZUDACTYWYPFLY-OWOJBTEDSA-N |
| SMILES | C(/C=C/C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)