Products 2340293-11-8
CAS 2340293-11-8 is the registry number for (5-(5-Fluoro-2-isopropoxyphenyl)-1h-pyrazol-3-yl)methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[3-(5-fluoro-2-propan-2-yloxyphenyl)-1H-pyrazol-5-yl]methanol (CAS 2340293-11-8) is a chemical compound with the molecular formula C13H15FN2O2 and a molecular weight of 250.27 g/mol. IUPAC name: [3-(5-fluoro-2-propan-2-yloxyphenyl)-1H-pyrazol-5-yl]methanol. InChIKey: SMYGBPKYQAKRQU-UHFFFAOYSA-N.
| Molecular formula | C13H15FN2O2 |
|---|---|
| Molecular weight | 250.27 g/mol |
| IUPAC name | [3-(5-fluoro-2-propan-2-yloxyphenyl)-1H-pyrazol-5-yl]methanol |
| InChIKey | SMYGBPKYQAKRQU-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1)F)C2=NNC(=C2)CO |
Computed by PubChem (NCBI)