CAS 2340293-86-7 is the registry number for N-(3-Chloro-5-methoxybenzyl)propan-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N-[(3-chloro-5-methoxyphenyl)methyl]propan-2-amine;hydrochloride (CAS 2340293-86-7) is a chemical compound with the molecular formula C11H17Cl2NO and a molecular weight of 250.16 g/mol. IUPAC name: N-[(3-chloro-5-methoxyphenyl)methyl]propan-2-amine;hydrochloride. InChIKey: UVVHRWBROYQEEQ-UHFFFAOYSA-N.
| Molecular formula | C11H17Cl2NO |
|---|---|
| Molecular weight | 250.16 g/mol |
| IUPAC name | N-[(3-chloro-5-methoxyphenyl)methyl]propan-2-amine;hydrochloride |
| InChIKey | UVVHRWBROYQEEQ-UHFFFAOYSA-N |
| SMILES | CC(C)NCC1=CC(=CC(=C1)Cl)OC.Cl |
Computed by PubChem (NCBI)