Products 2340293-90-3
CAS 2340293-90-3 is the registry number for tert-Butyl 3-((2-fluoro-4-formylphenoxy)methyl)azetidine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Tert-butyl 3-[(2-fluoro-4-formylphenoxy)methyl]azetidine-1-carboxylate (CAS 2340293-90-3) is a chemical compound with the molecular formula C16H20FNO4 and a molecular weight of 309.33 g/mol. IUPAC name: tert-butyl 3-[(2-fluoro-4-formylphenoxy)methyl]azetidine-1-carboxylate. InChIKey: LGZWICQHZWFGJI-UHFFFAOYSA-N.
| Molecular formula | C16H20FNO4 |
|---|---|
| Molecular weight | 309.33 g/mol |
| IUPAC name | tert-butyl 3-[(2-fluoro-4-formylphenoxy)methyl]azetidine-1-carboxylate |
| InChIKey | LGZWICQHZWFGJI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)COC2=C(C=C(C=C2)C=O)F |
Computed by PubChem (NCBI)