Products 2340294-26-8
CAS 2340294-26-8 is the registry number for tert-Butyl 3-bromo-5-fluorobenzyl(ethyl)carbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Tert-butyl N-[(3-bromo-5-fluorophenyl)methyl]-N-ethylcarbamate (CAS 2340294-26-8) is a chemical compound with the molecular formula C14H19BrFNO2 and a molecular weight of 332.21 g/mol. IUPAC name: tert-butyl N-[(3-bromo-5-fluorophenyl)methyl]-N-ethylcarbamate. InChIKey: DHYXWAZBBJFOMI-UHFFFAOYSA-N.
| Molecular formula | C14H19BrFNO2 |
|---|---|
| Molecular weight | 332.21 g/mol |
| IUPAC name | tert-butyl N-[(3-bromo-5-fluorophenyl)methyl]-N-ethylcarbamate |
| InChIKey | DHYXWAZBBJFOMI-UHFFFAOYSA-N |
| SMILES | CCN(CC1=CC(=CC(=C1)Br)F)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)